C16H20N6O3S — CID 159029635
4-[(7-ethyl-5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]benzenesulfonamide (PubChem CID 159029635) has the molecular formula C16H20N6O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is 4-[(7-ethyl-5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(7-ethyl-5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 159029635 |
| Molecular Formula | C16H20N6O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 4-[(7-ethyl-5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]benzenesulfonamide |
| SMILES | CCC1C(=O)N(C)c2cnc(Nc3ccc(S(N)(=O)=O)cc3)nc2N1C |
| InChI | InChI=1S/C16H20N6O3S/c1-4-12-15(23)22(3)13-9-18-16(20-14(13)21(12)2)19-10-5-7-11(8-6-10)26(17,24)25/h5-9,12H,4H2,1-3H3,(H2,17,24,25)(H,18,19,20) |
| InChIKey | JUSHLUFHADCANU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |