C20H20N6O3S — CID 162477908
4-[[(7R)-5,8-dimethyl-6-oxo-7-phenyl-7H-pteridin-2-yl]amino]benzenesulfonamide (PubChem CID 162477908) has the molecular formula C20H20N6O3S and a molecular weight of 424.49 g/mol. Its IUPAC name is 4-[[(7R)-5,8-dimethyl-6-oxo-7-phenyl-7H-pteridin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[(7R)-5,8-dimethyl-6-oxo-7-phenyl-7H-pteridin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 162477908 |
| Molecular Formula | C20H20N6O3S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 4-[[(7R)-5,8-dimethyl-6-oxo-7-phenyl-7H-pteridin-2-yl]amino]benzenesulfonamide |
| SMILES | CN1C(=O)[C@@H](c2ccccc2)N(C)c2nc(Nc3ccc(S(N)(=O)=O)cc3)ncc21 |
| InChI | InChI=1S/C20H20N6O3S/c1-25-16-12-22-20(23-14-8-10-15(11-9-14)30(21,28)29)24-18(16)26(2)17(19(25)27)13-6-4-3-5-7-13/h3-12,17H,1-2H3,(H2,21,28,29)(H,22,23,24)/t17-/m1/s1 |
| InChIKey | WBKPDOBQAFXAGB-QGZVFWFLSA-N |
| XLogP | 2.02 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |