C22H24F3N7O — CID 146194297
5,8-dimethyl-7-propyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-7H-pteridin-6-one (PubChem CID 146194297) has the molecular formula C22H24F3N7O and a molecular weight of 459.48 g/mol. Its IUPAC name is 5,8-dimethyl-7-propyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-7H-pteridin-6-one.
| Compound Name | 5,8-dimethyl-7-propyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-7H-pteridin-6-one |
|---|---|
| PubChem CID | 146194297 |
| Molecular Formula | C22H24F3N7O |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 5,8-dimethyl-7-propyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-7H-pteridin-6-one |
| SMILES | CCCC1C(=O)N(C)c2cnc(NCc3cnn(Cc4cc(F)c(F)c(F)c4)c3)nc2N1C |
| InChI | InChI=1S/C22H24F3N7O/c1-4-5-17-21(33)31(3)18-10-27-22(29-20(18)30(17)2)26-8-14-9-28-32(12-14)11-13-6-15(23)19(25)16(24)7-13/h6-7,9-10,12,17H,4-5,8,11H2,1-3H3,(H,26,27,29) |
| InChIKey | YNWSIQWXDATULY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|