C19H18F3N7O — CID 146194634
(7R)-7,8-dimethyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-5,7-dihydropteridin-6-one (PubChem CID 146194634) has the molecular formula C19H18F3N7O and a molecular weight of 417.40 g/mol. Its IUPAC name is (7R)-7,8-dimethyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-5,7-dihydropteridin-6-one.
| Compound Name | (7R)-7,8-dimethyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 146194634 |
| Molecular Formula | C19H18F3N7O |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (7R)-7,8-dimethyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-5,7-dihydropteridin-6-one |
| SMILES | C[C@@H]1C(=O)Nc2cnc(NCc3cnn(Cc4cc(F)c(F)c(F)c4)c3)nc2N1C |
| InChI | InChI=1S/C19H18F3N7O/c1-10-18(30)26-15-7-24-19(27-17(15)28(10)2)23-5-12-6-25-29(9-12)8-11-3-13(20)16(22)14(21)4-11/h3-4,6-7,9-10H,5,8H2,1-2H3,(H,26,30)(H,23,24,27)/t10-/m1/s1 |
| InChIKey | JYCRJJGMVHVKNG-SNVBAGLBSA-N |
| XLogP | 2.53 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|