C21H23FN6O — CID 158596474
5-ethyl-2-[2-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]ethyl]-8-methyl-7H-pteridin-6-one (PubChem CID 158596474) has the molecular formula C21H23FN6O and a molecular weight of 394.45 g/mol. Its IUPAC name is 5-ethyl-2-[2-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]ethyl]-8-methyl-7H-pteridin-6-one.
| Compound Name | 5-ethyl-2-[2-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]ethyl]-8-methyl-7H-pteridin-6-one |
|---|---|
| PubChem CID | 158596474 |
| Molecular Formula | C21H23FN6O |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 5-ethyl-2-[2-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]ethyl]-8-methyl-7H-pteridin-6-one |
| SMILES | CCN1C(=O)CN(C)c2nc(CCc3cnn(Cc4ccc(F)cc4)c3)ncc21 |
| InChI | InChI=1S/C21H23FN6O/c1-3-28-18-11-23-19(25-21(18)26(2)14-20(28)29)9-6-16-10-24-27(13-16)12-15-4-7-17(22)8-5-15/h4-5,7-8,10-11,13H,3,6,9,12,14H2,1-2H3 |
| InChIKey | HVCBNGNWNHANSG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |