C13H14ClFN2 — CID 63278715
4-(3-chloropropyl)-1-[(4-fluorophenyl)methyl]pyrazole (PubChem CID 63278715) has the molecular formula C13H14ClFN2 and a molecular weight of 252.72 g/mol. Its IUPAC name is 4-(3-chloropropyl)-1-[(4-fluorophenyl)methyl]pyrazole.
| Compound Name | 4-(3-chloropropyl)-1-[(4-fluorophenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 63278715 |
| Molecular Formula | C13H14ClFN2 |
| Molecular Weight | 252.72 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 4-(3-chloropropyl)-1-[(4-fluorophenyl)methyl]pyrazole |
| SMILES | Fc1ccc(Cn2cc(CCCCl)cn2)cc1 |
| InChI | InChI=1S/C13H14ClFN2/c14-7-1-2-12-8-16-17(10-12)9-11-3-5-13(15)6-4-11/h3-6,8,10H,1-2,7,9H2 |
| InChIKey | OCPAIRNTNLNBFK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.72 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|