C19H33N5O — CID 176926706
(13S)-6,8-diethyl-4,7,9,11,16-pentazatetracyclo[11.2.1.02,11.05,10]hexadeca-5,7,9-trien-3-one;ethane (PubChem CID 176926706) has the molecular formula C19H33N5O and a molecular weight of 347.51 g/mol. Its IUPAC name is (13S)-6,8-diethyl-4,7,9,11,16-pentazatetracyclo[11.2.1.02,11.05,10]hexadeca-5,7,9-trien-3-one;ethane.
| Compound Name | (13S)-6,8-diethyl-4,7,9,11,16-pentazatetracyclo[11.2.1.02,11.05,10]hexadeca-5,7,9-trien-3-one;ethane |
|---|---|
| PubChem CID | 176926706 |
| Molecular Formula | C19H33N5O |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | (13S)-6,8-diethyl-4,7,9,11,16-pentazatetracyclo[11.2.1.02,11.05,10]hexadeca-5,7,9-trien-3-one;ethane |
| SMILES | CC.CC.CCc1nc(CC)c2c(n1)N1C[C@@H]3CCC(N3)C1C(=O)N2 |
| InChI | InChI=1S/C15H21N5O.2C2H6/c1-3-9-12-14(18-11(4-2)17-9)20-7-8-5-6-10(16-8)13(20)15(21)19-12;2*1-2/h8,10,13,16H,3-7H2,1-2H3,(H,19,21);2*1-2H3/t8-,10?,13?;;/m0../s1 |
| InChIKey | GCUIBODHLYQNDP-QQZWYIMJSA-N |
| XLogP | 2.92 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |