C17H17ClF3N5S — CID 170423444
(4R,7S,8R)-13-chloro-17-ethylsulfanyl-10,10,14-trifluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene (PubChem CID 170423444) has the molecular formula C17H17ClF3N5S and a molecular weight of 415.87 g/mol. Its IUPAC name is (4R,7S,8R)-13-chloro-17-ethylsulfanyl-10,10,14-trifluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene.
| Compound Name | (4R,7S,8R)-13-chloro-17-ethylsulfanyl-10,10,14-trifluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene |
|---|---|
| PubChem CID | 170423444 |
| Molecular Formula | C17H17ClF3N5S |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | (4R,7S,8R)-13-chloro-17-ethylsulfanyl-10,10,14-trifluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene |
| SMILES | CCSc1nc2c3c(nc(Cl)c(F)c3n1)C(F)(F)C[C@@H]1[C@@H]3CC[C@H](CN21)N3 |
| InChI | InChI=1S/C17H17ClF3N5S/c1-2-27-16-23-12-10-13(24-14(18)11(12)19)17(20,21)5-9-8-4-3-7(22-8)6-26(9)15(10)25-16/h7-9,22H,2-6H2,1H3/t7-,8+,9-/m1/s1 |
| InChIKey | ZMLTXNIPOKVCPY-HRDYMLBCSA-N |
| XLogP | 3.73 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|