C24H31ClFN5O2S — CID 169315615
tert-butyl (4R,7S,8S,9S)-14-chloro-18-ethylsulfanyl-15-fluoro-9-methyl-2,13,17,19,21-pentazapentacyclo[10.7.1.14,7.02,8.016,20]henicosa-1(19),12(20),13,15,17-pentaene-21-carboxylate (PubChem CID 169315615) has the molecular formula C24H31ClFN5O2S and a molecular weight of 508.06 g/mol. Its IUPAC name is tert-butyl (4R,7S,8S,9S)-14-chloro-18-ethylsulfanyl-15-fluoro-9-methyl-2,13,17,19,21-pentazapentacyclo[10.7.1.14,7.02,8.016,20]henicosa-1(19),12(20),13,15,17-pentaene-21-carboxylate.
| Compound Name | tert-butyl (4R,7S,8S,9S)-14-chloro-18-ethylsulfanyl-15-fluoro-9-methyl-2,13,17,19,21-pentazapentacyclo[10.7.1.14,7.02,8.016,20]henicosa-1(19),12(20),13,15,17-pentaene-21-carboxylate |
|---|---|
| PubChem CID | 169315615 |
| Molecular Formula | C24H31ClFN5O2S |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | tert-butyl (4R,7S,8S,9S)-14-chloro-18-ethylsulfanyl-15-fluoro-9-methyl-2,13,17,19,21-pentazapentacyclo[10.7.1.14,7.02,8.016,20]henicosa-1(19),12(20),13,15,17-pentaene-21-carboxylate |
| SMILES | CCSc1nc2c3c(nc(Cl)c(F)c3n1)CC[C@H](C)[C@H]1[C@@H]3CC[C@H](CN21)N3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31ClFN5O2S/c1-6-34-22-28-18-16-14(27-20(25)17(18)26)9-7-12(2)19-15-10-8-13(11-30(19)21(16)29-22)31(15)23(32)33-24(3,4)5/h12-13,15,19H,6-11H2,1-5H3/t12-,13+,15-,19-/m0/s1 |
| InChIKey | BDNFARZFJJVWAZ-QPWUGHHJSA-N |
| XLogP | 5.47 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|