C34H33F2N5O2S — CID 169315557
tert-butyl (4R,7S,8S)-17-ethylsulfanyl-13-(8-ethynyl-7-fluoronaphthalen-1-yl)-14-fluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene-20-carboxylate (PubChem CID 169315557) has the molecular formula C34H33F2N5O2S and a molecular weight of 613.73 g/mol. Its IUPAC name is tert-butyl (4R,7S,8S)-17-ethylsulfanyl-13-(8-ethynyl-7-fluoronaphthalen-1-yl)-14-fluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene-20-carboxylate.
| Compound Name | tert-butyl (4R,7S,8S)-17-ethylsulfanyl-13-(8-ethynyl-7-fluoronaphthalen-1-yl)-14-fluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene-20-carboxylate |
|---|---|
| PubChem CID | 169315557 |
| Molecular Formula | C34H33F2N5O2S |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | tert-butyl (4R,7S,8S)-17-ethylsulfanyl-13-(8-ethynyl-7-fluoronaphthalen-1-yl)-14-fluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene-20-carboxylate |
| SMILES | C#Cc1c(F)ccc2cccc(-c3nc4c5c(nc(SCC)nc5c3F)N3C[C@H]5CC[C@@H]([C@@H]3CC4)N5C(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C34H33F2N5O2S/c1-6-20-22(35)13-11-18-9-8-10-21(26(18)20)29-28(36)30-27-23(37-29)14-16-24-25-15-12-19(41(25)33(42)43-34(3,4)5)17-40(24)31(27)39-32(38-30)44-7-2/h1,8-11,13,19,24-25H,7,12,14-17H2,2-5H3/t19-,24+,25+/m1/s1 |
| InChIKey | JIOHKQJBCHXOLX-NGXZDTIWSA-N |
| XLogP | 7.12 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|