C23H27BrF2N4O2S — CID 177090673
tert-butyl (4R,7S,8S,9S)-13-bromo-12,14-difluoro-9-methyl-17-methylsulfanyl-2,16,18,20-tetrazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene-20-carboxylate (PubChem CID 177090673) has the molecular formula C23H27BrF2N4O2S and a molecular weight of 541.46 g/mol. Its IUPAC name is tert-butyl (4R,7S,8S,9S)-13-bromo-12,14-difluoro-9-methyl-17-methylsulfanyl-2,16,18,20-tetrazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene-20-carboxylate.
| Compound Name | tert-butyl (4R,7S,8S,9S)-13-bromo-12,14-difluoro-9-methyl-17-methylsulfanyl-2,16,18,20-tetrazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene-20-carboxylate |
|---|---|
| PubChem CID | 177090673 |
| Molecular Formula | C23H27BrF2N4O2S |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | tert-butyl (4R,7S,8S,9S)-13-bromo-12,14-difluoro-9-methyl-17-methylsulfanyl-2,16,18,20-tetrazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene-20-carboxylate |
| SMILES | CSc1nc2c3c(c(F)c(Br)c(F)c3n1)C[C@H](C)[C@H]1[C@@H]3CC[C@H](CN21)N3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H27BrF2N4O2S/c1-10-8-12-14-18(17(26)15(24)16(12)25)27-21(33-5)28-20(14)29-9-11-6-7-13(19(10)29)30(11)22(31)32-23(2,3)4/h10-11,13,19H,6-9H2,1-5H3/t10-,11+,13-,19-/m0/s1 |
| InChIKey | PWCKVJBWIZUZOG-GCOBWHKUSA-N |
| XLogP | 5.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|