C22H27ClFN5O3S — CID 176778360
tert-butyl (4R,7S)-13-chloro-9-ethyl-14-fluoro-17-methylsulfanyl-10-oxa-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-20-carboxylate (PubChem CID 176778360) has the molecular formula C22H27ClFN5O3S and a molecular weight of 496.01 g/mol. Its IUPAC name is tert-butyl (4R,7S)-13-chloro-9-ethyl-14-fluoro-17-methylsulfanyl-10-oxa-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-20-carboxylate.
| Compound Name | tert-butyl (4R,7S)-13-chloro-9-ethyl-14-fluoro-17-methylsulfanyl-10-oxa-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-20-carboxylate |
|---|---|
| PubChem CID | 176778360 |
| Molecular Formula | C22H27ClFN5O3S |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | tert-butyl (4R,7S)-13-chloro-9-ethyl-14-fluoro-17-methylsulfanyl-10-oxa-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-20-carboxylate |
| SMILES | CCC1Oc2nc(Cl)c(F)c3nc(SC)nc(c23)N2C[C@H]3CC[C@@H](C12)N3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27ClFN5O3S/c1-6-12-16-11-8-7-10(29(11)21(30)32-22(2,3)4)9-28(16)18-13-15(25-20(27-18)33-5)14(24)17(23)26-19(13)31-12/h10-12,16H,6-9H2,1-5H3/t10-,11+,12?,16?/m1/s1 |
| InChIKey | NJESDYIZBDUQTJ-GUVYTERUSA-N |
| XLogP | 4.67 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|