C21H29ClFN5O3S — CID 177041617
tert-butyl (8S)-12-chloro-3-ethyl-13-fluoro-8-methyl-16-methylsulfanyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate (PubChem CID 177041617) has the molecular formula C21H29ClFN5O3S and a molecular weight of 486.01 g/mol. Its IUPAC name is tert-butyl (8S)-12-chloro-3-ethyl-13-fluoro-8-methyl-16-methylsulfanyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate.
| Compound Name | tert-butyl (8S)-12-chloro-3-ethyl-13-fluoro-8-methyl-16-methylsulfanyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 177041617 |
| Molecular Formula | C21H29ClFN5O3S |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | tert-butyl (8S)-12-chloro-3-ethyl-13-fluoro-8-methyl-16-methylsulfanyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate |
| SMILES | CCC1CN(C(=O)OC(C)(C)C)CC[C@H](C)Oc2nc(Cl)c(F)c3nc(SC)nc(c23)N1 |
| InChI | InChI=1S/C21H29ClFN5O3S/c1-7-12-10-28(20(29)31-21(3,4)5)9-8-11(2)30-18-13-15(14(23)16(22)26-18)25-19(32-6)27-17(13)24-12/h11-12H,7-10H2,1-6H3,(H,24,25,27)/t11-,12?/m0/s1 |
| InChIKey | WMLNGRVQQIJCNX-PXYINDEMSA-N |
| XLogP | 5.14 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|