C19H21BrClFN4O3S — CID 171756046
tert-butyl 15-bromo-16-chloro-14-fluoro-8-methyl-11-methylsulfanyl-2-oxa-5,8,10,12-tetrazatetracyclo[7.7.1.03,7.013,17]heptadeca-1(16),9,11,13(17),14-pentaene-5-carboxylate (PubChem CID 171756046) has the molecular formula C19H21BrClFN4O3S and a molecular weight of 519.82 g/mol. Its IUPAC name is tert-butyl 15-bromo-16-chloro-14-fluoro-8-methyl-11-methylsulfanyl-2-oxa-5,8,10,12-tetrazatetracyclo[7.7.1.03,7.013,17]heptadeca-1(16),9,11,13(17),14-pentaene-5-carboxylate.
| Compound Name | tert-butyl 15-bromo-16-chloro-14-fluoro-8-methyl-11-methylsulfanyl-2-oxa-5,8,10,12-tetrazatetracyclo[7.7.1.03,7.013,17]heptadeca-1(16),9,11,13(17),14-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 171756046 |
| Molecular Formula | C19H21BrClFN4O3S |
| Molecular Weight | 519.82 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | tert-butyl 15-bromo-16-chloro-14-fluoro-8-methyl-11-methylsulfanyl-2-oxa-5,8,10,12-tetrazatetracyclo[7.7.1.03,7.013,17]heptadeca-1(16),9,11,13(17),14-pentaene-5-carboxylate |
| SMILES | CSc1nc2c3c(c(Cl)c(Br)c(F)c3n1)OC1CN(C(=O)OC(C)(C)C)CC1N2C |
| InChI | InChI=1S/C19H21BrClFN4O3S/c1-19(2,3)29-18(27)26-6-8-9(7-26)28-15-10-14(13(22)11(20)12(15)21)23-17(30-5)24-16(10)25(8)4/h8-9H,6-7H2,1-5H3 |
| InChIKey | YEANNZFVIMPUIJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.82 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|