C19H21BrClF3N4O3S — CID 176724900
tert-butyl N-[[(12S)-7-bromo-8-chloro-13-(2,2-difluoroethyl)-6-fluoro-3-methylsulfanyl-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-12-yl]methyl]carbamate (PubChem CID 176724900) has the molecular formula C19H21BrClF3N4O3S and a molecular weight of 557.82 g/mol. Its IUPAC name is tert-butyl N-[[(12S)-7-bromo-8-chloro-13-(2,2-difluoroethyl)-6-fluoro-3-methylsulfanyl-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-12-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(12S)-7-bromo-8-chloro-13-(2,2-difluoroethyl)-6-fluoro-3-methylsulfanyl-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-12-yl]methyl]carbamate |
|---|---|
| PubChem CID | 176724900 |
| Molecular Formula | C19H21BrClF3N4O3S |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 556.02 |
| IUPAC Name | tert-butyl N-[[(12S)-7-bromo-8-chloro-13-(2,2-difluoroethyl)-6-fluoro-3-methylsulfanyl-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-12-yl]methyl]carbamate |
| SMILES | CSc1nc2c3c(c(Cl)c(Br)c(F)c3n1)OC[C@H](CNC(=O)OC(C)(C)C)N2CC(F)F |
| InChI | InChI=1S/C19H21BrClF3N4O3S/c1-19(2,3)31-18(29)25-5-8-7-30-15-10-14(13(24)11(20)12(15)21)26-17(32-4)27-16(10)28(8)6-9(22)23/h8-9H,5-7H2,1-4H3,(H,25,29)/t8-/m0/s1 |
| InChIKey | HHROQEINKHIPCQ-QMMMGPOBSA-N |
| XLogP | 5.26 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|