C22H24ClFN6O3S — CID 171756897
tert-butyl N-[3-[(1R)-1-(7-chloro-6-fluoro-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl)ethyl]-2-pyridinyl]carbamate (PubChem CID 171756897) has the molecular formula C22H24ClFN6O3S and a molecular weight of 506.99 g/mol. Its IUPAC name is tert-butyl N-[3-[(1R)-1-(7-chloro-6-fluoro-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl)ethyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[3-[(1R)-1-(7-chloro-6-fluoro-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl)ethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 171756897 |
| Molecular Formula | C22H24ClFN6O3S |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | tert-butyl N-[3-[(1R)-1-(7-chloro-6-fluoro-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl)ethyl]-2-pyridinyl]carbamate |
| SMILES | CSc1nc2c3c(nc(Cl)c(F)c3n1)OCCN2[C@H](C)c1cccnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H24ClFN6O3S/c1-11(12-7-6-8-25-17(12)28-21(31)33-22(2,3)4)30-9-10-32-19-13-15(14(24)16(23)27-19)26-20(34-5)29-18(13)30/h6-8,11H,9-10H2,1-5H3,(H,25,28,31)/t11-/m1/s1 |
| InChIKey | SEZWKKNFDKDJNI-LLVKDONJSA-N |
| XLogP | 5.24 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|