C17H13BrClFN6OS — CID 176724652
7-bromo-8-chloro-6-fluoro-13-[(4-isocyano-1-methylpyrazol-5-yl)methyl]-3-methylsulfanyl-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene (PubChem CID 176724652) has the molecular formula C17H13BrClFN6OS and a molecular weight of 483.75 g/mol. Its IUPAC name is 7-bromo-8-chloro-6-fluoro-13-[(4-isocyano-1-methylpyrazol-5-yl)methyl]-3-methylsulfanyl-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene.
| Compound Name | 7-bromo-8-chloro-6-fluoro-13-[(4-isocyano-1-methylpyrazol-5-yl)methyl]-3-methylsulfanyl-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
|---|---|
| PubChem CID | 176724652 |
| Molecular Formula | C17H13BrClFN6OS |
| Molecular Weight | 483.75 g/mol |
| Exact Mass | 481.97 |
| IUPAC Name | 7-bromo-8-chloro-6-fluoro-13-[(4-isocyano-1-methylpyrazol-5-yl)methyl]-3-methylsulfanyl-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
| SMILES | [C-]#[N+]c1cnn(C)c1CN1CCOc2c(Cl)c(Br)c(F)c3nc(SC)nc1c23 |
| InChI | InChI=1S/C17H13BrClFN6OS/c1-21-8-6-22-25(2)9(8)7-26-4-5-27-15-10-14(13(20)11(18)12(15)19)23-17(28-3)24-16(10)26/h6H,4-5,7H2,2-3H3 |
| InChIKey | HYULQCZNKZWSTP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.75 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|