C21H24ClFN4O3S — CID 176974515
7-chloro-13-[(3,5-dimethoxyphenyl)methyl]-6-fluoro-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene;ethane (PubChem CID 176974515) has the molecular formula C21H24ClFN4O3S and a molecular weight of 466.97 g/mol. Its IUPAC name is 7-chloro-13-[(3,5-dimethoxyphenyl)methyl]-6-fluoro-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene;ethane.
| Compound Name | 7-chloro-13-[(3,5-dimethoxyphenyl)methyl]-6-fluoro-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene;ethane |
|---|---|
| PubChem CID | 176974515 |
| Molecular Formula | C21H24ClFN4O3S |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 7-chloro-13-[(3,5-dimethoxyphenyl)methyl]-6-fluoro-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene;ethane |
| SMILES | CC.COc1cc(CN2CCOc3nc(Cl)c(F)c4nc(SC)nc2c34)cc(OC)c1 |
| InChI | InChI=1S/C19H18ClFN4O3S.C2H6/c1-26-11-6-10(7-12(8-11)27-2)9-25-4-5-28-18-13-15(14(21)16(20)23-18)22-19(29-3)24-17(13)25;1-2/h6-8H,4-5,9H2,1-3H3;1-2H3 |
| InChIKey | BOSYITBEDIOHKN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|