C15H14BrClFN3OS — CID 176852249
(6R)-12-bromo-11-chloro-13-fluoro-16-methylsulfanyl-9-oxa-2,15,17-triazatetracyclo[8.7.1.02,6.014,18]octadeca-1(17),10,12,14(18),15-pentaene (PubChem CID 176852249) has the molecular formula C15H14BrClFN3OS and a molecular weight of 418.72 g/mol. Its IUPAC name is (6R)-12-bromo-11-chloro-13-fluoro-16-methylsulfanyl-9-oxa-2,15,17-triazatetracyclo[8.7.1.02,6.014,18]octadeca-1(17),10,12,14(18),15-pentaene.
| Compound Name | (6R)-12-bromo-11-chloro-13-fluoro-16-methylsulfanyl-9-oxa-2,15,17-triazatetracyclo[8.7.1.02,6.014,18]octadeca-1(17),10,12,14(18),15-pentaene |
|---|---|
| PubChem CID | 176852249 |
| Molecular Formula | C15H14BrClFN3OS |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | (6R)-12-bromo-11-chloro-13-fluoro-16-methylsulfanyl-9-oxa-2,15,17-triazatetracyclo[8.7.1.02,6.014,18]octadeca-1(17),10,12,14(18),15-pentaene |
| SMILES | CSc1nc2c3c(c(Cl)c(Br)c(F)c3n1)OCC[C@H]1CCCN21 |
| InChI | InChI=1S/C15H14BrClFN3OS/c1-23-15-19-12-8-13(10(17)9(16)11(12)18)22-6-4-7-3-2-5-21(7)14(8)20-15/h7H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | DGUBNCGZJXQVIB-SSDOTTSWSA-N |
| XLogP | 4.66 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|