C22H28BrClFN5O2S — CID 169254929
tert-butyl 4-(5-bromo-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-3-but-3-enylpiperazine-1-carboxylate (PubChem CID 169254929) has the molecular formula C22H28BrClFN5O2S and a molecular weight of 560.92 g/mol. Its IUPAC name is tert-butyl 4-(5-bromo-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-3-but-3-enylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-bromo-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-3-but-3-enylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 169254929 |
| Molecular Formula | C22H28BrClFN5O2S |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | tert-butyl 4-(5-bromo-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-3-but-3-enylpiperazine-1-carboxylate |
| SMILES | C=CCCC1CN(C(=O)OC(C)(C)C)CCN1c1nc(SCC)nc2c(F)c(Cl)nc(Br)c12 |
| InChI | InChI=1S/C22H28BrClFN5O2S/c1-6-8-9-13-12-29(21(31)32-22(3,4)5)10-11-30(13)19-14-16(26-20(28-19)33-7-2)15(25)18(24)27-17(14)23/h6,13H,1,7-12H2,2-5H3 |
| InChIKey | RHVUQFPGSFDOCJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|