C28H43BBrClFN5O4S — CID 169255772
tert-butyl 4-(5-bromo-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]piperazine-1-carboxylate;ethane (PubChem CID 169255772) has the molecular formula C28H43BBrClFN5O4S and a molecular weight of 690.92 g/mol. Its IUPAC name is tert-butyl 4-(5-bromo-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(5-bromo-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 169255772 |
| Molecular Formula | C28H43BBrClFN5O4S |
| Molecular Weight | 690.92 g/mol |
| Exact Mass | 689.20 |
| IUPAC Name | tert-butyl 4-(5-bromo-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]piperazine-1-carboxylate;ethane |
| SMILES | CC.CCSc1nc(N2CCN(C(=O)OC(C)(C)C)CC2CCB2OC(C)(C)C(C)(C)O2)c2c(Br)nc(Cl)c(F)c2n1 |
| InChI | InChI=1S/C26H37BBrClFN5O4S.C2H6/c1-9-40-22-31-18-16(19(28)32-20(29)17(18)30)21(33-22)35-13-12-34(23(36)37-24(2,3)4)14-15(35)10-11-27-38-25(5,6)26(7,8)39-27;1-2/h15H,9-14H2,1-8H3;1-2H3 |
| InChIKey | WREOCFQRYZMNSU-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 89.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.92 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|