C23H33ClFN5O2S — CID 169255548
tert-butyl N-[(7-chloro-3-ethylsulfanyl-6-fluoro-10-methyl-2,4,8,14-tetrazatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaen-13-yl)methyl]-N-propylcarbamate (PubChem CID 169255548) has the molecular formula C23H33ClFN5O2S and a molecular weight of 498.07 g/mol. Its IUPAC name is tert-butyl N-[(7-chloro-3-ethylsulfanyl-6-fluoro-10-methyl-2,4,8,14-tetrazatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaen-13-yl)methyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[(7-chloro-3-ethylsulfanyl-6-fluoro-10-methyl-2,4,8,14-tetrazatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaen-13-yl)methyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 169255548 |
| Molecular Formula | C23H33ClFN5O2S |
| Molecular Weight | 498.07 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | tert-butyl N-[(7-chloro-3-ethylsulfanyl-6-fluoro-10-methyl-2,4,8,14-tetrazatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaen-13-yl)methyl]-N-propylcarbamate |
| SMILES | CCCN(CC1CCC(C)c2nc(Cl)c(F)c3nc(SCC)nc(c23)N1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33ClFN5O2S/c1-7-11-30(22(31)32-23(4,5)6)12-14-10-9-13(3)17-15-18(16(25)19(24)27-17)28-21(33-8-2)29-20(15)26-14/h13-14H,7-12H2,1-6H3,(H,26,28,29) |
| InChIKey | VGIUHNZELIWSCX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.07 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|