C29H43ClFN5O4 — CID 178163646
tert-butyl N-[[7-chloro-6-fluoro-4,11-dimethyl-3-(5-oxopyrrolidin-2-yl)-10-oxa-2,8,13-triazatricyclo[7.4.1.05,14]tetradeca-1(14),2,4,6,8-pentaen-12-yl]methyl]-N-pentan-2-ylcarbamate;ethane (PubChem CID 178163646) has the molecular formula C29H43ClFN5O4 and a molecular weight of 580.15 g/mol. Its IUPAC name is tert-butyl N-[[7-chloro-6-fluoro-4,11-dimethyl-3-(5-oxopyrrolidin-2-yl)-10-oxa-2,8,13-triazatricyclo[7.4.1.05,14]tetradeca-1(14),2,4,6,8-pentaen-12-yl]methyl]-N-pentan-2-ylcarbamate;ethane.
| Compound Name | tert-butyl N-[[7-chloro-6-fluoro-4,11-dimethyl-3-(5-oxopyrrolidin-2-yl)-10-oxa-2,8,13-triazatricyclo[7.4.1.05,14]tetradeca-1(14),2,4,6,8-pentaen-12-yl]methyl]-N-pentan-2-ylcarbamate;ethane |
|---|---|
| PubChem CID | 178163646 |
| Molecular Formula | C29H43ClFN5O4 |
| Molecular Weight | 580.15 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | tert-butyl N-[[7-chloro-6-fluoro-4,11-dimethyl-3-(5-oxopyrrolidin-2-yl)-10-oxa-2,8,13-triazatricyclo[7.4.1.05,14]tetradeca-1(14),2,4,6,8-pentaen-12-yl]methyl]-N-pentan-2-ylcarbamate;ethane |
| SMILES | CC.CCCC(C)N(CC1Nc2nc(C3CCC(=O)N3)c(C)c3c(F)c(Cl)nc(c23)OC1C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H37ClFN5O4.C2H6/c1-8-9-13(2)34(26(36)38-27(5,6)7)12-17-15(4)37-25-20-19(21(29)23(28)33-25)14(3)22(32-24(20)31-17)16-10-11-18(35)30-16;1-2/h13,15-17H,8-12H2,1-7H3,(H,30,35)(H,31,32);1-2H3 |
| InChIKey | VDNRUXXQNFGXSW-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.15 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|