C26H38ClFN4O4 — CID 178163922
tert-butyl 12-chloro-4-(ethoxymethyl)-7-ethyl-13-fluoro-8,15,16-trimethyl-9-oxa-2,5,11,17-tetrazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate (PubChem CID 178163922) has the molecular formula C26H38ClFN4O4 and a molecular weight of 525.07 g/mol. Its IUPAC name is tert-butyl 12-chloro-4-(ethoxymethyl)-7-ethyl-13-fluoro-8,15,16-trimethyl-9-oxa-2,5,11,17-tetrazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate.
| Compound Name | tert-butyl 12-chloro-4-(ethoxymethyl)-7-ethyl-13-fluoro-8,15,16-trimethyl-9-oxa-2,5,11,17-tetrazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 178163922 |
| Molecular Formula | C26H38ClFN4O4 |
| Molecular Weight | 525.07 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | tert-butyl 12-chloro-4-(ethoxymethyl)-7-ethyl-13-fluoro-8,15,16-trimethyl-9-oxa-2,5,11,17-tetrazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate |
| SMILES | CCOCC1CNc2nc(C)c(C)c3c(F)c(Cl)nc(c23)OC(C)C(CC)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38ClFN4O4/c1-9-17-12-32(25(33)36-26(6,7)8)18(13-34-10-2)11-29-23-20-19(14(3)15(4)30-23)21(28)22(27)31-24(20)35-16(17)5/h16-18H,9-13H2,1-8H3,(H,29,30) |
| InChIKey | FSXPUCXLVVWRGX-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.07 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|