C27H34ClFN4O5 — CID 178163751
20-O-tert-butyl 4-O-propan-2-yl (4R,7S,8S)-13-chloro-14-fluoro-9,16,17-trimethyl-10-oxa-2,12,18,20-tetrazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-4,20-dicarboxylate (PubChem CID 178163751) has the molecular formula C27H34ClFN4O5 and a molecular weight of 549.04 g/mol. Its IUPAC name is 20-O-tert-butyl 4-O-propan-2-yl (4R,7S,8S)-13-chloro-14-fluoro-9,16,17-trimethyl-10-oxa-2,12,18,20-tetrazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-4,20-dicarboxylate.
| Compound Name | 20-O-tert-butyl 4-O-propan-2-yl (4R,7S,8S)-13-chloro-14-fluoro-9,16,17-trimethyl-10-oxa-2,12,18,20-tetrazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-4,20-dicarboxylate |
|---|---|
| PubChem CID | 178163751 |
| Molecular Formula | C27H34ClFN4O5 |
| Molecular Weight | 549.04 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 20-O-tert-butyl 4-O-propan-2-yl (4R,7S,8S)-13-chloro-14-fluoro-9,16,17-trimethyl-10-oxa-2,12,18,20-tetrazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-4,20-dicarboxylate |
| SMILES | Cc1nc2c3c(nc(Cl)c(F)c3c1C)OC(C)[C@@H]1[C@@H]3CC[C@](C(=O)OC(C)C)(CN21)N3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H34ClFN4O5/c1-12(2)36-24(34)27-10-9-16(33(27)25(35)38-26(6,7)8)20-15(5)37-23-18-17(19(29)21(28)31-23)13(3)14(4)30-22(18)32(20)11-27/h12,15-16,20H,9-11H2,1-8H3/t15?,16-,20+,27+/m0/s1 |
| InChIKey | GIBSXHJRHRFMBR-XJLQHXNISA-N |
| XLogP | 5.10 |
| TPSA | 94.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.04 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|