C14H23N3O2 — CID 73134613
3-(cyclohexylmethyl)-3,6,7,8,9,9a-hexahydro-2H-pyrazino[1,2-a]pyrazine-1,4-dione (PubChem CID 73134613) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-3,6,7,8,9,9a-hexahydro-2H-pyrazino[1,2-a]pyrazine-1,4-dione.
| Compound Name | 3-(cyclohexylmethyl)-3,6,7,8,9,9a-hexahydro-2H-pyrazino[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 73134613 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3-(cyclohexylmethyl)-3,6,7,8,9,9a-hexahydro-2H-pyrazino[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1NC(CC2CCCCC2)C(=O)N2CCNCC12 |
| InChI | InChI=1S/C14H23N3O2/c18-13-12-9-15-6-7-17(12)14(19)11(16-13)8-10-4-2-1-3-5-10/h10-12,15H,1-9H2,(H,16,18) |
| InChIKey | IIARXVGZWBMUGN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |