C20H32N4O4 — CID 59844510
ethyl (4R,7Z,14S)-14-amino-2,15-dioxo-3,16,19-triazatricyclo[14.4.0.04,6]icos-7-ene-4-carboxylate (PubChem CID 59844510) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is ethyl (4R,7Z,14S)-14-amino-2,15-dioxo-3,16,19-triazatricyclo[14.4.0.04,6]icos-7-ene-4-carboxylate.
| Compound Name | ethyl (4R,7Z,14S)-14-amino-2,15-dioxo-3,16,19-triazatricyclo[14.4.0.04,6]icos-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 59844510 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | ethyl (4R,7Z,14S)-14-amino-2,15-dioxo-3,16,19-triazatricyclo[14.4.0.04,6]icos-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12CC1/C=C\CCCCC[C@H](N)C(=O)N1CCNCC1C(=O)N2 |
| InChI | InChI=1S/C20H32N4O4/c1-2-28-19(27)20-12-14(20)8-6-4-3-5-7-9-15(21)18(26)24-11-10-22-13-16(24)17(25)23-20/h6,8,14-16,22H,2-5,7,9-13,21H2,1H3,(H,23,25)/b8-6-/t14?,15-,16?,20+/m0/s1 |
| InChIKey | WGPDUZDKYNTTRS-GWINKKJZSA-N |
| XLogP | 0.07 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|