C25H37N3O6 — CID 143018615
methyl (4R,7Z,14S)-14-(cyclopentyloxycarbonylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate (PubChem CID 143018615) has the molecular formula C25H37N3O6 and a molecular weight of 475.59 g/mol. Its IUPAC name is methyl (4R,7Z,14S)-14-(cyclopentyloxycarbonylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate.
| Compound Name | methyl (4R,7Z,14S)-14-(cyclopentyloxycarbonylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 143018615 |
| Molecular Formula | C25H37N3O6 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | methyl (4R,7Z,14S)-14-(cyclopentyloxycarbonylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
| SMILES | COC(=O)[C@@]12CC1/C=C\CCCCC[C@H](NC(=O)OC1CCCC1)C(=O)N1CCCC1C(=O)N2 |
| InChI | InChI=1S/C25H37N3O6/c1-33-23(31)25-16-17(25)10-5-3-2-4-6-13-19(26-24(32)34-18-11-7-8-12-18)22(30)28-15-9-14-20(28)21(29)27-25/h5,10,17-20H,2-4,6-9,11-16H2,1H3,(H,26,32)(H,27,29)/b10-5-/t17?,19-,20?,25+/m0/s1 |
| InChIKey | AVITUDLOMNFHGI-XJLDFWCXSA-N |
| XLogP | 2.58 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|