C29H39FN4O5 — CID 90940748
tert-butyl N-[(4R,6S,14S)-4-[(4-fluorophenyl)carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 90940748) has the molecular formula C29H39FN4O5 and a molecular weight of 542.65 g/mol. Its IUPAC name is tert-butyl N-[(4R,6S,14S)-4-[(4-fluorophenyl)carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | tert-butyl N-[(4R,6S,14S)-4-[(4-fluorophenyl)carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 90940748 |
| Molecular Formula | C29H39FN4O5 |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | tert-butyl N-[(4R,6S,14S)-4-[(4-fluorophenyl)carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCCC=C[C@@H]2C[C@@]2(C(=O)Nc2ccc(F)cc2)NC(=O)C2CCCN2C1=O |
| InChI | InChI=1S/C29H39FN4O5/c1-28(2,3)39-27(38)32-22-11-8-6-4-5-7-10-19-18-29(19,26(37)31-21-15-13-20(30)14-16-21)33-24(35)23-12-9-17-34(23)25(22)36/h7,10,13-16,19,22-23H,4-6,8-9,11-12,17-18H2,1-3H3,(H,31,37)(H,32,38)(H,33,35)/t19-,22+,23?,29-/m1/s1 |
| InChIKey | BSZJXZWAWWUBBX-QBKBWRIGSA-N |
| XLogP | 4.04 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|