C32H43N3O9S — CID 89374282
methyl (1S,4R,6S,7Z,14S,18S)-14-(cyclopentyloxycarbonylamino)-18-(4-methylphenyl)sulfonyloxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate (PubChem CID 89374282) has the molecular formula C32H43N3O9S and a molecular weight of 645.78 g/mol. Its IUPAC name is methyl (1S,4R,6S,7Z,14S,18S)-14-(cyclopentyloxycarbonylamino)-18-(4-methylphenyl)sulfonyloxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate.
| Compound Name | methyl (1S,4R,6S,7Z,14S,18S)-14-(cyclopentyloxycarbonylamino)-18-(4-methylphenyl)sulfonyloxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 89374282 |
| Molecular Formula | C32H43N3O9S |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | methyl (1S,4R,6S,7Z,14S,18S)-14-(cyclopentyloxycarbonylamino)-18-(4-methylphenyl)sulfonyloxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@H]1/C=C\CCCCC[C@H](NC(=O)OC1CCCC1)C(=O)N1C[C@@H](OS(=O)(=O)c3ccc(C)cc3)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C32H43N3O9S/c1-21-14-16-25(17-15-21)45(40,41)44-24-18-27-28(36)34-32(30(38)42-2)19-22(32)10-6-4-3-5-7-13-26(29(37)35(27)20-24)33-31(39)43-23-11-8-9-12-23/h6,10,14-17,22-24,26-27H,3-5,7-9,11-13,18-20H2,1-2H3,(H,33,39)(H,34,36)/b10-6-/t22-,24+,26+,27+,32-/m1/s1 |
| InChIKey | JUWFHAIXDFKLDT-RSPQAUINSA-N |
| XLogP | 3.28 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|