C17H27N3O5 — CID 71028389
ethyl (1R,4S,12Z,14S)-4-(hydroxymethyl)-7-methyl-3,6-dioxo-2,5,7-triazabicyclo[12.1.0]pentadec-12-ene-1-carboxylate (PubChem CID 71028389) has the molecular formula C17H27N3O5 and a molecular weight of 353.42 g/mol. Its IUPAC name is ethyl (1R,4S,12Z,14S)-4-(hydroxymethyl)-7-methyl-3,6-dioxo-2,5,7-triazabicyclo[12.1.0]pentadec-12-ene-1-carboxylate.
| Compound Name | ethyl (1R,4S,12Z,14S)-4-(hydroxymethyl)-7-methyl-3,6-dioxo-2,5,7-triazabicyclo[12.1.0]pentadec-12-ene-1-carboxylate |
|---|---|
| PubChem CID | 71028389 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | ethyl (1R,4S,12Z,14S)-4-(hydroxymethyl)-7-methyl-3,6-dioxo-2,5,7-triazabicyclo[12.1.0]pentadec-12-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]1/C=C\CCCCN(C)C(=O)N[C@@H](CO)C(=O)N2 |
| InChI | InChI=1S/C17H27N3O5/c1-3-25-15(23)17-10-12(17)8-6-4-5-7-9-20(2)16(24)18-13(11-21)14(22)19-17/h6,8,12-13,21H,3-5,7,9-11H2,1-2H3,(H,18,24)(H,19,22)/b8-6-/t12-,13+,17-/m1/s1 |
| InChIKey | DOHLYSXHLMNHNR-QBFGTYNNSA-N |
| XLogP | 0.17 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|