C24H38N4O6 — CID 59838982
ethyl (1S,4R,6R,7Z,17R)-17-methyl-13-[(2-methylpropan-2-yl)oxycarbonylamino]-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate (PubChem CID 59838982) has the molecular formula C24H38N4O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is ethyl (1S,4R,6R,7Z,17R)-17-methyl-13-[(2-methylpropan-2-yl)oxycarbonylamino]-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate.
| Compound Name | ethyl (1S,4R,6R,7Z,17R)-17-methyl-13-[(2-methylpropan-2-yl)oxycarbonylamino]-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 59838982 |
| Molecular Formula | C24H38N4O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | ethyl (1S,4R,6R,7Z,17R)-17-methyl-13-[(2-methylpropan-2-yl)oxycarbonylamino]-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@@H]1/C=C\CCCCN(NC(=O)OC(C)(C)C)C(=O)N1C[C@H](C)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C24H38N4O6/c1-6-33-20(30)24-14-17(24)11-9-7-8-10-12-28(26-21(31)34-23(3,4)5)22(32)27-15-16(2)13-18(27)19(29)25-24/h9,11,16-18H,6-8,10,12-15H2,1-5H3,(H,25,29)(H,26,31)/b11-9-/t16-,17+,18+,24-/m1/s1 |
| InChIKey | LOCYHFXEPHVYEO-WRUVSKASSA-N |
| XLogP | 2.74 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|