C36H43N5O7 — CID 91283774
ethyl (1S,4R,6S,17R)-17-(fluoren-9-ylideneamino)oxy-13-[(2-methylpropan-2-yl)oxycarbonylamino]-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate (PubChem CID 91283774) has the molecular formula C36H43N5O7 and a molecular weight of 657.77 g/mol. Its IUPAC name is ethyl (1S,4R,6S,17R)-17-(fluoren-9-ylideneamino)oxy-13-[(2-methylpropan-2-yl)oxycarbonylamino]-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate.
| Compound Name | ethyl (1S,4R,6S,17R)-17-(fluoren-9-ylideneamino)oxy-13-[(2-methylpropan-2-yl)oxycarbonylamino]-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 91283774 |
| Molecular Formula | C36H43N5O7 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.32 |
| IUPAC Name | ethyl (1S,4R,6S,17R)-17-(fluoren-9-ylideneamino)oxy-13-[(2-methylpropan-2-yl)oxycarbonylamino]-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]1C=CCCCCN(NC(=O)OC(C)(C)C)C(=O)N1C[C@H](ON=C3c4ccccc4-c4ccccc43)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C36H43N5O7/c1-5-46-32(43)36-21-23(36)14-8-6-7-13-19-41(38-33(44)47-35(2,3)4)34(45)40-22-24(20-29(40)31(42)37-36)48-39-30-27-17-11-9-15-25(27)26-16-10-12-18-28(26)30/h8-12,14-18,23-24,29H,5-7,13,19-22H2,1-4H3,(H,37,42)(H,38,44)/t23-,24-,29+,36-/m1/s1 |
| InChIKey | WSZURTXXHHYWIL-PQCAGZAFSA-N |
| XLogP | 4.92 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|