C26H40N2O6 — CID 118012095
ethyl (1S,4S,6R,7Z,14R)-14-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate (PubChem CID 118012095) has the molecular formula C26H40N2O6 and a molecular weight of 476.61 g/mol. Its IUPAC name is ethyl (1S,4S,6R,7Z,14R)-14-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate.
| Compound Name | ethyl (1S,4S,6R,7Z,14R)-14-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 118012095 |
| Molecular Formula | C26H40N2O6 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | ethyl (1S,4S,6R,7Z,14R)-14-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@@H]1/C=C\CCCCC[C@H](CC(=O)OC(C)(C)C)C(=O)N1CCC[C@H]1C(=O)N2 |
| InChI | InChI=1S/C26H40N2O6/c1-5-33-24(32)26-17-19(26)13-10-8-6-7-9-12-18(16-21(29)34-25(2,3)4)23(31)28-15-11-14-20(28)22(30)27-26/h10,13,18-20H,5-9,11-12,14-17H2,1-4H3,(H,27,30)/b13-10-/t18-,19+,20+,26+/m1/s1 |
| InChIKey | XDHWVQAHDNQIGE-RKPDQFNPSA-N |
| XLogP | 3.28 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|