C26H40N4O4 — CID 118258815
(1S,4R,6S,7Z,14R)-N-methyl-2,15-dioxo-14-(2-oxo-2-piperidin-1-ylethyl)-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide (PubChem CID 118258815) has the molecular formula C26H40N4O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is (1S,4R,6S,7Z,14R)-N-methyl-2,15-dioxo-14-(2-oxo-2-piperidin-1-ylethyl)-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide.
| Compound Name | (1S,4R,6S,7Z,14R)-N-methyl-2,15-dioxo-14-(2-oxo-2-piperidin-1-ylethyl)-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
|---|---|
| PubChem CID | 118258815 |
| Molecular Formula | C26H40N4O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | (1S,4R,6S,7Z,14R)-N-methyl-2,15-dioxo-14-(2-oxo-2-piperidin-1-ylethyl)-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
| SMILES | CNC(=O)[C@@]12C[C@H]1/C=C\CCCCC[C@H](CC(=O)N1CCCCC1)C(=O)N1CCC[C@H]1C(=O)N2 |
| InChI | InChI=1S/C26H40N4O4/c1-27-25(34)26-18-20(26)12-7-4-2-3-6-11-19(17-22(31)29-14-8-5-9-15-29)24(33)30-16-10-13-21(30)23(32)28-26/h7,12,19-21H,2-6,8-11,13-18H2,1H3,(H,27,34)(H,28,32)/b12-7-/t19-,20-,21+,26-/m1/s1 |
| InChIKey | AEBZPDPLFPOPIW-DWRIVFRCSA-N |
| XLogP | 2.14 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|