C24H38N4O5 — CID 118258824
(3R,9Z,12R,15S)-N-methyl-3-(2-morpholin-4-yl-2-oxoethyl)-2,14-dioxo-1,13-diazabicyclo[13.3.0]octadec-9-ene-12-carboxamide (PubChem CID 118258824) has the molecular formula C24H38N4O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is (3R,9Z,12R,15S)-N-methyl-3-(2-morpholin-4-yl-2-oxoethyl)-2,14-dioxo-1,13-diazabicyclo[13.3.0]octadec-9-ene-12-carboxamide.
| Compound Name | (3R,9Z,12R,15S)-N-methyl-3-(2-morpholin-4-yl-2-oxoethyl)-2,14-dioxo-1,13-diazabicyclo[13.3.0]octadec-9-ene-12-carboxamide |
|---|---|
| PubChem CID | 118258824 |
| Molecular Formula | C24H38N4O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | (3R,9Z,12R,15S)-N-methyl-3-(2-morpholin-4-yl-2-oxoethyl)-2,14-dioxo-1,13-diazabicyclo[13.3.0]octadec-9-ene-12-carboxamide |
| SMILES | CNC(=O)[C@H]1C/C=C\CCCCC[C@H](CC(=O)N2CCOCC2)C(=O)N2CCC[C@H]2C(=O)N1 |
| InChI | InChI=1S/C24H38N4O5/c1-25-22(30)19-10-7-5-3-2-4-6-9-18(17-21(29)27-13-15-33-16-14-27)24(32)28-12-8-11-20(28)23(31)26-19/h5,7,18-20H,2-4,6,8-17H2,1H3,(H,25,30)(H,26,31)/b7-5-/t18-,19-,20+/m1/s1 |
| InChIKey | GEARTPFKVKQXCX-JVMXQRKCSA-N |
| XLogP | 0.98 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|