C17H25N3O5 — CID 159274047
methyl (3S,8S,14S)-3-methyl-2,10,13-trioxo-1,9,12-triazabicyclo[12.3.0]heptadec-5-ene-8-carboxylate (PubChem CID 159274047) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is methyl (3S,8S,14S)-3-methyl-2,10,13-trioxo-1,9,12-triazabicyclo[12.3.0]heptadec-5-ene-8-carboxylate.
| Compound Name | methyl (3S,8S,14S)-3-methyl-2,10,13-trioxo-1,9,12-triazabicyclo[12.3.0]heptadec-5-ene-8-carboxylate |
|---|---|
| PubChem CID | 159274047 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | methyl (3S,8S,14S)-3-methyl-2,10,13-trioxo-1,9,12-triazabicyclo[12.3.0]heptadec-5-ene-8-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=CC[C@H](C)C(=O)N2CCC[C@H]2C(=O)NCC(=O)N1 |
| InChI | InChI=1S/C17H25N3O5/c1-11-6-3-4-7-12(17(24)25-2)19-14(21)10-18-15(22)13-8-5-9-20(13)16(11)23/h3-4,11-13H,5-10H2,1-2H3,(H,18,22)(H,19,21)/t11-,12-,13-/m0/s1 |
| InChIKey | KYBPTSWUECWQHM-AVGNSLFASA-N |
| XLogP | -0.26 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|