C20H34N6O6S — CID 139030305
(2S)-6-amino-2-[[(3S,4S,7R,13S)-3-amino-4-methyl-2,9,12-trioxo-5-thia-1,8,11-triazabicyclo[11.3.0]hexadecane-7-carbonyl]amino]hexanoic acid (PubChem CID 139030305) has the molecular formula C20H34N6O6S and a molecular weight of 486.60 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(3S,4S,7R,13S)-3-amino-4-methyl-2,9,12-trioxo-5-thia-1,8,11-triazabicyclo[11.3.0]hexadecane-7-carbonyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(3S,4S,7R,13S)-3-amino-4-methyl-2,9,12-trioxo-5-thia-1,8,11-triazabicyclo[11.3.0]hexadecane-7-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 139030305 |
| Molecular Formula | C20H34N6O6S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (2S)-6-amino-2-[[(3S,4S,7R,13S)-3-amino-4-methyl-2,9,12-trioxo-5-thia-1,8,11-triazabicyclo[11.3.0]hexadecane-7-carbonyl]amino]hexanoic acid |
| SMILES | C[C@@H]1SC[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)CNC(=O)[C@@H]2CCCN2C(=O)[C@@H]1N |
| InChI | InChI=1S/C20H34N6O6S/c1-11-16(22)19(30)26-8-4-6-14(26)18(29)23-9-15(27)24-13(10-33-11)17(28)25-12(20(31)32)5-2-3-7-21/h11-14,16H,2-10,21-22H2,1H3,(H,23,29)(H,24,27)(H,25,28)(H,31,32)/t11-,12-,13-,14-,16+/m0/s1 |
| InChIKey | ROLUITODRNNLIC-SMSYFYOWSA-N |
| XLogP | -2.26 |
| TPSA | 196.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|