C11H21N3O3 — CID 140967117
(2S)-6-amino-2-[[(2S)-1-deuteriopyrrolidine-2-carbonyl]amino]hexanoic acid (PubChem CID 140967117) has the molecular formula C11H21N3O3 and a molecular weight of 244.31 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-1-deuteriopyrrolidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-1-deuteriopyrrolidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 140967117 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-1-deuteriopyrrolidine-2-carbonyl]amino]hexanoic acid |
| SMILES | [2H]N1CCC[C@H]1C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C11H21N3O3/c12-6-2-1-4-9(11(16)17)14-10(15)8-5-3-7-13-8/h8-9,13H,1-7,12H2,(H,14,15)(H,16,17)/t8-,9-/m0/s1/i/hD |
| InChIKey | RVQDZELMXZRSSI-MVFRVHBGSA-N |
| XLogP | -0.56 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|