C16H26N4O5 — CID 91232458
(8aS)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione;methyl 2-[[(2S)-1-methylpyrrolidine-2-carbonyl]amino]acetate (PubChem CID 91232458) has the molecular formula C16H26N4O5 and a molecular weight of 354.41 g/mol. Its IUPAC name is (8aS)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione;methyl 2-[[(2S)-1-methylpyrrolidine-2-carbonyl]amino]acetate.
| Compound Name | (8aS)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione;methyl 2-[[(2S)-1-methylpyrrolidine-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 91232458 |
| Molecular Formula | C16H26N4O5 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (8aS)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione;methyl 2-[[(2S)-1-methylpyrrolidine-2-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@@H]1CCCN1C.O=C1NCC(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C9H16N2O3.C7H10N2O2/c1-11-5-3-4-7(11)9(13)10-6-8(12)14-2;10-6-4-8-7(11)5-2-1-3-9(5)6/h7H,3-6H2,1-2H3,(H,10,13);5H,1-4H2,(H,8,11)/t7-;5-/m00/s1 |
| InChIKey | JGUVQYKBJWXTEB-SJEAMFKXSA-N |
| XLogP | -1.52 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |