C15H23N5O5S2 — CID 177437326
(11R,14S)-6-acetamido-2,5,13-trioxo-8,9-dithia-1,4,12-triazabicyclo[12.3.0]heptadecane-11-carboxamide (PubChem CID 177437326) has the molecular formula C15H23N5O5S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (11R,14S)-6-acetamido-2,5,13-trioxo-8,9-dithia-1,4,12-triazabicyclo[12.3.0]heptadecane-11-carboxamide.
| Compound Name | (11R,14S)-6-acetamido-2,5,13-trioxo-8,9-dithia-1,4,12-triazabicyclo[12.3.0]heptadecane-11-carboxamide |
|---|---|
| PubChem CID | 177437326 |
| Molecular Formula | C15H23N5O5S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (11R,14S)-6-acetamido-2,5,13-trioxo-8,9-dithia-1,4,12-triazabicyclo[12.3.0]heptadecane-11-carboxamide |
| SMILES | CC(=O)NC1CSSC[C@@H](C(N)=O)NC(=O)[C@@H]2CCCN2C(=O)CNC1=O |
| InChI | InChI=1S/C15H23N5O5S2/c1-8(21)18-10-7-27-26-6-9(13(16)23)19-15(25)11-3-2-4-20(11)12(22)5-17-14(10)24/h9-11H,2-7H2,1H3,(H2,16,23)(H,17,24)(H,18,21)(H,19,25)/t9-,10?,11-/m0/s1 |
| InChIKey | WWDBFHFZPBSMHF-JRUYECLLSA-N |
| XLogP | -2.04 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|