C30H42N5O9PS2 — CID 71458088
methyl (6R,9R,15S,20S,23R)-15-acetamido-6-benzyl-5-hydroxy-2,5,8,14,22-pentaoxo-17,18-dithia-1,7,13,21-tetraza-5λ5-phosphatricyclo[21.3.0.09,13]hexacosane-20-carboxylate (PubChem CID 71458088) has the molecular formula C30H42N5O9PS2 and a molecular weight of 711.80 g/mol. Its IUPAC name is methyl (6R,9R,15S,20S,23R)-15-acetamido-6-benzyl-5-hydroxy-2,5,8,14,22-pentaoxo-17,18-dithia-1,7,13,21-tetraza-5λ5-phosphatricyclo[21.3.0.09,13]hexacosane-20-carboxylate.
| Compound Name | methyl (6R,9R,15S,20S,23R)-15-acetamido-6-benzyl-5-hydroxy-2,5,8,14,22-pentaoxo-17,18-dithia-1,7,13,21-tetraza-5λ5-phosphatricyclo[21.3.0.09,13]hexacosane-20-carboxylate |
|---|---|
| PubChem CID | 71458088 |
| Molecular Formula | C30H42N5O9PS2 |
| Molecular Weight | 711.80 g/mol |
| Exact Mass | 711.22 |
| IUPAC Name | methyl (6R,9R,15S,20S,23R)-15-acetamido-6-benzyl-5-hydroxy-2,5,8,14,22-pentaoxo-17,18-dithia-1,7,13,21-tetraza-5λ5-phosphatricyclo[21.3.0.09,13]hexacosane-20-carboxylate |
| SMILES | COC(=O)[C@H]1CSSC[C@@H](NC(C)=O)C(=O)N2CCC[C@@H]2C(=O)N[C@@H](Cc2ccccc2)P(=O)(O)CCC(=O)N2CCC[C@@H]2C(=O)N1 |
| InChI | InChI=1S/C30H42N5O9PS2/c1-19(36)31-21-17-46-47-18-22(30(41)44-2)32-27(38)23-10-6-13-34(23)26(37)12-15-45(42,43)25(16-20-8-4-3-5-9-20)33-28(39)24-11-7-14-35(24)29(21)40/h3-5,8-9,21-25H,6-7,10-18H2,1-2H3,(H,31,36)(H,32,38)(H,33,39)(H,42,43)/t21-,22-,23-,24-,25-/m1/s1 |
| InChIKey | QHITXSQLMRRZHM-FXEFVXDJSA-N |
| XLogP | 0.87 |
| TPSA | 191.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.80 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|