C10H14N2O4 — CID 62027090
methyl 1-(2,5-dioxopyrrolidin-3-yl)pyrrolidine-2-carboxylate (PubChem CID 62027090) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl 1-(2,5-dioxopyrrolidin-3-yl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(2,5-dioxopyrrolidin-3-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 62027090 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | methyl 1-(2,5-dioxopyrrolidin-3-yl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C1CC(=O)NC1=O |
| InChI | InChI=1S/C10H14N2O4/c1-16-10(15)6-3-2-4-12(6)7-5-8(13)11-9(7)14/h6-7H,2-5H2,1H3,(H,11,13,14) |
| InChIKey | UCWNFKIVWJLECU-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|