C12H19NO3 — CID 10632958
methyl (5S,8E,8aS)-8-(methoxymethylidene)-2,3,5,6,7,8a-hexahydro-1H-indolizine-5-carboxylate (PubChem CID 10632958) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is methyl (5S,8E,8aS)-8-(methoxymethylidene)-2,3,5,6,7,8a-hexahydro-1H-indolizine-5-carboxylate.
| Compound Name | methyl (5S,8E,8aS)-8-(methoxymethylidene)-2,3,5,6,7,8a-hexahydro-1H-indolizine-5-carboxylate |
|---|---|
| PubChem CID | 10632958 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | methyl (5S,8E,8aS)-8-(methoxymethylidene)-2,3,5,6,7,8a-hexahydro-1H-indolizine-5-carboxylate |
| SMILES | CO/C=C1\CC[C@@H](C(=O)OC)N2CCC[C@@H]12 |
| InChI | InChI=1S/C12H19NO3/c1-15-8-9-5-6-11(12(14)16-2)13-7-3-4-10(9)13/h8,10-11H,3-7H2,1-2H3/b9-8+/t10-,11-/m0/s1 |
| InChIKey | QSOYZEBJCNYDIV-WRSFFWLLSA-N |
| XLogP | 1.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|