C16H25N3O5 — CID 68954718
(1R,4S,12Z,14S)-4-(2-hydroxyethyl)-7-methyl-3,6-dioxo-2,5,7-triazabicyclo[12.1.0]pentadec-12-ene-1-carboxylic acid (PubChem CID 68954718) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is (1R,4S,12Z,14S)-4-(2-hydroxyethyl)-7-methyl-3,6-dioxo-2,5,7-triazabicyclo[12.1.0]pentadec-12-ene-1-carboxylic acid.
| Compound Name | (1R,4S,12Z,14S)-4-(2-hydroxyethyl)-7-methyl-3,6-dioxo-2,5,7-triazabicyclo[12.1.0]pentadec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 68954718 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (1R,4S,12Z,14S)-4-(2-hydroxyethyl)-7-methyl-3,6-dioxo-2,5,7-triazabicyclo[12.1.0]pentadec-12-ene-1-carboxylic acid |
| SMILES | CN1CCCC/C=C\[C@@H]2C[C@@]2(C(=O)O)NC(=O)[C@H](CCO)NC1=O |
| InChI | InChI=1S/C16H25N3O5/c1-19-8-5-3-2-4-6-11-10-16(11,14(22)23)18-13(21)12(7-9-20)17-15(19)24/h4,6,11-12,20H,2-3,5,7-10H2,1H3,(H,17,24)(H,18,21)(H,22,23)/b6-4-/t11-,12+,16-/m1/s1 |
| InChIKey | BFYYYCMKBCFRRJ-QVPCITAFSA-N |
| XLogP | 0.08 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|