C25H30N6O4 — CID 69233646
13-methyl-2,14-dioxo-17-(5-phenyltetrazol-2-yl)-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid (PubChem CID 69233646) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 13-methyl-2,14-dioxo-17-(5-phenyltetrazol-2-yl)-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid.
| Compound Name | 13-methyl-2,14-dioxo-17-(5-phenyltetrazol-2-yl)-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 69233646 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 13-methyl-2,14-dioxo-17-(5-phenyltetrazol-2-yl)-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
| SMILES | CN1CCCCC=CC2CC2(C(=O)O)NC(=O)C2CC(n3nnc(-c4ccccc4)n3)CC2C1=O |
| InChI | InChI=1S/C25H30N6O4/c1-30-12-8-3-2-7-11-17-15-25(17,24(34)35)26-22(32)19-13-18(14-20(19)23(30)33)31-28-21(27-29-31)16-9-5-4-6-10-16/h4-7,9-11,17-20H,2-3,8,12-15H2,1H3,(H,26,32)(H,34,35) |
| InChIKey | YJWZZONWUAQHIJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|