C21H31N3O6S — CID 91273887
(1R,4R,6S,15R,17S)-N-cyclopropylsulfonyl-17-hydroxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxamide (PubChem CID 91273887) has the molecular formula C21H31N3O6S and a molecular weight of 453.56 g/mol. Its IUPAC name is (1R,4R,6S,15R,17S)-N-cyclopropylsulfonyl-17-hydroxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxamide.
| Compound Name | (1R,4R,6S,15R,17S)-N-cyclopropylsulfonyl-17-hydroxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxamide |
|---|---|
| PubChem CID | 91273887 |
| Molecular Formula | C21H31N3O6S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (1R,4R,6S,15R,17S)-N-cyclopropylsulfonyl-17-hydroxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxamide |
| SMILES | CN1CCCCC=C[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]2C[C@H](O)C[C@H]2C1=O |
| InChI | InChI=1S/C21H31N3O6S/c1-24-9-5-3-2-4-6-13-12-21(13,20(28)23-31(29,30)15-7-8-15)22-18(26)16-10-14(25)11-17(16)19(24)27/h4,6,13-17,25H,2-3,5,7-12H2,1H3,(H,22,26)(H,23,28)/t13-,14+,16-,17-,21-/m1/s1 |
| InChIKey | MPRHHTCNSOOIIJ-BEJVLZFQSA-N |
| XLogP | 0.06 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|