C30H38N4O7S — CID 15987286
[(1R,4R,6S,7Z,15R,17R)-4-(cyclopropylsulfonylcarbamoyl)-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-en-17-yl] 1,3-dihydroisoindole-2-carboxylate (PubChem CID 15987286) has the molecular formula C30H38N4O7S and a molecular weight of 598.72 g/mol. Its IUPAC name is [(1R,4R,6S,7Z,15R,17R)-4-(cyclopropylsulfonylcarbamoyl)-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-en-17-yl] 1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(1R,4R,6S,7Z,15R,17R)-4-(cyclopropylsulfonylcarbamoyl)-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-en-17-yl] 1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 15987286 |
| Molecular Formula | C30H38N4O7S |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | [(1R,4R,6S,7Z,15R,17R)-4-(cyclopropylsulfonylcarbamoyl)-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-en-17-yl] 1,3-dihydroisoindole-2-carboxylate |
| SMILES | CN1CCCC/C=C\[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]2C[C@@H](OC(=O)N3Cc4ccccc4C3)C[C@H]2C1=O |
| InChI | InChI=1S/C30H38N4O7S/c1-33-13-7-3-2-4-10-21-16-30(21,28(37)32-42(39,40)23-11-12-23)31-26(35)24-14-22(15-25(24)27(33)36)41-29(38)34-17-19-8-5-6-9-20(19)18-34/h4-6,8-10,21-25H,2-3,7,11-18H2,1H3,(H,31,35)(H,32,37)/b10-4-/t21-,22-,24-,25-,30-/m1/s1 |
| InChIKey | DHIZATTVCPTPMT-IQGLNNTBSA-N |
| XLogP | 2.22 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|