C22H33N3O6S — CID 173294583
(1R,4R,7Z,15R,17R)-17-hydroxy-13-methyl-N-(1-methylcyclopropyl)sulfonyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxamide (PubChem CID 173294583) has the molecular formula C22H33N3O6S and a molecular weight of 467.59 g/mol. Its IUPAC name is (1R,4R,7Z,15R,17R)-17-hydroxy-13-methyl-N-(1-methylcyclopropyl)sulfonyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxamide.
| Compound Name | (1R,4R,7Z,15R,17R)-17-hydroxy-13-methyl-N-(1-methylcyclopropyl)sulfonyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxamide |
|---|---|
| PubChem CID | 173294583 |
| Molecular Formula | C22H33N3O6S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | (1R,4R,7Z,15R,17R)-17-hydroxy-13-methyl-N-(1-methylcyclopropyl)sulfonyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxamide |
| SMILES | CN1CCCC/C=C\C2C[C@@]2(C(=O)NS(=O)(=O)C2(C)CC2)NC(=O)[C@@H]2C[C@@H](O)C[C@H]2C1=O |
| InChI | InChI=1S/C22H33N3O6S/c1-21(8-9-21)32(30,31)24-20(29)22-13-14(22)7-5-3-4-6-10-25(2)19(28)17-12-15(26)11-16(17)18(27)23-22/h5,7,14-17,26H,3-4,6,8-13H2,1-2H3,(H,23,27)(H,24,29)/b7-5-/t14?,15-,16-,17-,22-/m1/s1 |
| InChIKey | XJKBWFRHWIDPQX-NDEWZQCPSA-N |
| XLogP | 0.45 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|