C19H30N2O6 — CID 146788595
ethyl (1S,4R,6S,7Z,18R)-15,18-dihydroxy-2-oxo-12-oxa-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate (PubChem CID 146788595) has the molecular formula C19H30N2O6 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethyl (1S,4R,6S,7Z,18R)-15,18-dihydroxy-2-oxo-12-oxa-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate.
| Compound Name | ethyl (1S,4R,6S,7Z,18R)-15,18-dihydroxy-2-oxo-12-oxa-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 146788595 |
| Molecular Formula | C19H30N2O6 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | ethyl (1S,4R,6S,7Z,18R)-15,18-dihydroxy-2-oxo-12-oxa-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]1/C=C\CCCOCCC(O)N1C[C@H](O)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C19H30N2O6/c1-2-27-18(25)19-11-13(19)6-4-3-5-8-26-9-7-16(23)21-12-14(22)10-15(21)17(24)20-19/h4,6,13-16,22-23H,2-3,5,7-12H2,1H3,(H,20,24)/b6-4-/t13-,14-,15+,16?,19-/m1/s1 |
| InChIKey | RVJHBSRZOPFZTA-CGEJDXNYSA-N |
| XLogP | -0.07 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|